C32H39N7O5 — CID 90951907
N-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-N-(2-piperidin-1-ylethyl)-7H-purine-2-carboxamide (PubChem CID 90951907) has the molecular formula C32H39N7O5 and a molecular weight of 601.71 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-N-(2-piperidin-1-ylethyl)-7H-purine-2-carboxamide.
| Compound Name | N-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-N-(2-piperidin-1-ylethyl)-7H-purine-2-carboxamide |
|---|---|
| PubChem CID | 90951907 |
| Molecular Formula | C32H39N7O5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | N-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-N-(2-piperidin-1-ylethyl)-7H-purine-2-carboxamide |
| SMILES | O=C(c1nc(NCC(c2ccccc2)c2ccccc2)c2[nH]cnc2n1)N(CCN1CCCCC1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H39N7O5/c40-19-24-26(41)27(42)32(44-24)39(17-16-38-14-8-3-9-15-38)31(43)30-36-28(25-29(37-30)35-20-34-25)33-18-23(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-2,4-7,10-13,20,23-24,26-27,32,40-42H,3,8-9,14-19H2,(H2,33,34,35,36,37)/t24-,26-,27-,32-/m1/s1 |
| InChIKey | HHLULHHYCOZPGP-YVIFWTNJSA-N |
| XLogP | 1.96 |
| TPSA | 159.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |