C35H65N5 — CID 90952503
4,5,9,10,14,15,19,20,24,25-decamethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane (PubChem CID 90952503) has the molecular formula C35H65N5 and a molecular weight of 555.94 g/mol. Its IUPAC name is 4,5,9,10,14,15,19,20,24,25-decamethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane.
| Compound Name | 4,5,9,10,14,15,19,20,24,25-decamethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane |
|---|---|
| PubChem CID | 90952503 |
| Molecular Formula | C35H65N5 |
| Molecular Weight | 555.94 g/mol |
| Exact Mass | 555.52 |
| IUPAC Name | 4,5,9,10,14,15,19,20,24,25-decamethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane |
| SMILES | CC1C2CC3NC(CC4NC(CC5NC(CC6NC(CC(N2)C1C)C(C)C6C)C(C)C5C)C(C)C4C)C(C)C3C |
| InChI | InChI=1S/C35H65N5/c1-16-17(2)27-12-29-20(5)21(6)31(38-29)14-33-24(9)25(10)35(40-33)15-34-23(8)22(7)32(39-34)13-30-19(4)18(3)28(37-30)11-26(16)36-27/h16-40H,11-15H2,1-10H3 |
| InChIKey | ICUPHIAVZTVSQZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |