About 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine
1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine (PubChem CID 90952514) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine.
Molecular Properties
| Compound Name | 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine |
| PubChem CID | 90952514 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine |
| SMILES | CCCCN1CNC=C1CN1C=CC=CC1 |
| InChI | InChI=1S/C13H21N3/c1-2-3-9-16-12-14-10-13(16)11-15-7-5-4-6-8-15/h4-7,10,14H,2-3,8-9,11-12H2,1H3 |
| InChIKey | QPUNZNOLKFJRLQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine?
The IUPAC name of 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine (CID 90952514) is 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine.
What is the SMILES notation for 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine?
The canonical SMILES for 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine is CCCCN1CNC=C1CN1C=CC=CC1.
What is the InChIKey of 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine?
The InChIKey is QPUNZNOLKFJRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-2-3-9-16-12-14-10-13(16)11-15-7-5-4-6-8-15/h4-7,10,14H,2-3,8-9,11-12H2,1H3.
What are the key properties of 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine?
1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine has a molecular weight of 219.33 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-butyl-1,2-dihydroimidazol-4-yl)methyl]-2H-pyridine is sourced from PubChem (CID 90952514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).