About trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane
trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane (PubChem CID 90952529) has the molecular formula C17H36N4OSi4
and a molecular weight of 424.85 g/mol. Its IUPAC name is trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane |
| PubChem CID | 90952529 |
| Molecular Formula | C17H36N4OSi4 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane |
| SMILES | C[Si](C)(C)Oc1nc([Si](C)(C)C)nc2nc([Si](C)(C)C)n([Si](C)(C)C)c12 |
| InChI | InChI=1S/C17H36N4OSi4/c1-23(2,3)16-18-14-13(15(20-16)22-26(10,11)12)21(25(7,8)9)17(19-14)24(4,5)6/h1-12H3 |
| InChIKey | SGCFWWROXDOONZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane?
The IUPAC name of trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane (CID 90952529) is trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane.
What is the SMILES notation for trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane?
The canonical SMILES for trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane is C[Si](C)(C)Oc1nc([Si](C)(C)C)nc2nc([Si](C)(C)C)n([Si](C)(C)C)c12.
What is the InChIKey of trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane?
The InChIKey is SGCFWWROXDOONZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N4OSi4/c1-23(2,3)16-18-14-13(15(20-16)22-26(10,11)12)21(25(7,8)9)17(19-14)24(4,5)6/h1-12H3.
What are the key properties of trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane?
trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane has a molecular weight of 424.85 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2,7,8-tris(trimethylsilyl)purin-6-yl]oxysilane is sourced from PubChem (CID 90952529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).