C21H37FN6O3 — CID 90952865
4-fluoro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,3,5-triazin-2-amine (PubChem CID 90952865) has the molecular formula C21H37FN6O3 and a molecular weight of 440.56 g/mol. Its IUPAC name is 4-fluoro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,3,5-triazin-2-amine.
| Compound Name | 4-fluoro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90952865 |
| Molecular Formula | C21H37FN6O3 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 4-fluoro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,3,5-triazin-2-amine |
| SMILES | CC1(C)CC(Nc2nc(F)nc(OC3CC(C)(C)N(O)C(C)(C)C3)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C21H37FN6O3/c1-18(2)9-13(10-19(3,4)27(18)29)23-16-24-15(22)25-17(26-16)31-14-11-20(5,6)28(30)21(7,8)12-14/h13-14,29-30H,9-12H2,1-8H3,(H,23,24,25,26) |
| InChIKey | WRSLGTQICNDMSW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |