About 1,7-naphthyridine-3,6-dicarboxamide
1,7-naphthyridine-3,6-dicarboxamide (PubChem CID 90953080) has the molecular formula C10H8N4O2
and a molecular weight of 216.20 g/mol. Its IUPAC name is 1,7-naphthyridine-3,6-dicarboxamide.
Molecular Properties
| Compound Name | 1,7-naphthyridine-3,6-dicarboxamide |
| PubChem CID | 90953080 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1,7-naphthyridine-3,6-dicarboxamide |
| SMILES | NC(=O)c1cnc2cnc(C(N)=O)cc2c1 |
| InChI | InChI=1S/C10H8N4O2/c11-9(15)6-1-5-2-7(10(12)16)14-4-8(5)13-3-6/h1-4H,(H2,11,15)(H2,12,16) |
| InChIKey | QHCJPEXXZIESQQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,7-naphthyridine-3,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-naphthyridine-3,6-dicarboxamide?
The IUPAC name of 1,7-naphthyridine-3,6-dicarboxamide (CID 90953080) is 1,7-naphthyridine-3,6-dicarboxamide.
What is the SMILES notation for 1,7-naphthyridine-3,6-dicarboxamide?
The canonical SMILES for 1,7-naphthyridine-3,6-dicarboxamide is NC(=O)c1cnc2cnc(C(N)=O)cc2c1.
What is the InChIKey of 1,7-naphthyridine-3,6-dicarboxamide?
The InChIKey is QHCJPEXXZIESQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O2/c11-9(15)6-1-5-2-7(10(12)16)14-4-8(5)13-3-6/h1-4H,(H2,11,15)(H2,12,16).
What are the key properties of 1,7-naphthyridine-3,6-dicarboxamide?
1,7-naphthyridine-3,6-dicarboxamide has a molecular weight of 216.20 g/mol, XLogP of -0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-naphthyridine-3,6-dicarboxamide is sourced from PubChem (CID 90953080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).