About 2-ethenylhexanenitrile
2-ethenylhexanenitrile (PubChem CID 90953191) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 2-ethenylhexanenitrile.
Molecular Properties
| Compound Name | 2-ethenylhexanenitrile |
| PubChem CID | 90953191 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2-ethenylhexanenitrile |
| SMILES | C=CC(C#N)CCCC |
| InChI | InChI=1S/C8H13N/c1-3-5-6-8(4-2)7-9/h4,8H,2-3,5-6H2,1H3 |
| InChIKey | HVGAZBFAVHSHJI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylhexanenitrile?
The IUPAC name of 2-ethenylhexanenitrile (CID 90953191) is 2-ethenylhexanenitrile.
What is the SMILES notation for 2-ethenylhexanenitrile?
The canonical SMILES for 2-ethenylhexanenitrile is C=CC(C#N)CCCC.
What is the InChIKey of 2-ethenylhexanenitrile?
The InChIKey is HVGAZBFAVHSHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-3-5-6-8(4-2)7-9/h4,8H,2-3,5-6H2,1H3.
What are the key properties of 2-ethenylhexanenitrile?
2-ethenylhexanenitrile has a molecular weight of 123.20 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylhexanenitrile is sourced from PubChem (CID 90953191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).