C20H22N2O2 — CID 90953201
2-(2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indol-8-yl)-3-phenylpropanoic acid (PubChem CID 90953201) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indol-8-yl)-3-phenylpropanoic acid.
| Compound Name | 2-(2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indol-8-yl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90953201 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indol-8-yl)-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)c1ccc2c(c1)C1CNCCC1N2 |
| InChI | InChI=1S/C20H22N2O2/c23-20(24)15(10-13-4-2-1-3-5-13)14-6-7-18-16(11-14)17-12-21-9-8-19(17)22-18/h1-7,11,15,17,19,21-22H,8-10,12H2,(H,23,24) |
| InChIKey | SNFHEALETLDZPM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |