C18H17F5N6OS — CID 90953346
2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 90953346) has the molecular formula C18H17F5N6OS and a molecular weight of 460.43 g/mol. Its IUPAC name is 2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 90953346 |
| Molecular Formula | C18H17F5N6OS |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | N#CC(c1ccnc(NCCCN2CCCC2=O)n1)c1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H17F5N6OS/c19-17(20,18(21,22)23)13-10-31-15(28-13)11(9-24)12-4-6-26-16(27-12)25-5-2-8-29-7-1-3-14(29)30/h4,6,10-11H,1-3,5,7-8H2,(H,25,26,27) |
| InChIKey | NDYIXWKQKSNVEH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|