C40H72N2 — CID 90953628
7-cyclooctyl-4-ethyl-2-[5-ethyl-4-(4-ethylnonan-4-yl)-3,4-dimethylcyclononyl]-2,3-dihydroazepin-6-imine (PubChem CID 90953628) has the molecular formula C40H72N2 and a molecular weight of 581.03 g/mol. Its IUPAC name is 7-cyclooctyl-4-ethyl-2-[5-ethyl-4-(4-ethylnonan-4-yl)-3,4-dimethylcyclononyl]-2,3-dihydroazepin-6-imine.
| Compound Name | 7-cyclooctyl-4-ethyl-2-[5-ethyl-4-(4-ethylnonan-4-yl)-3,4-dimethylcyclononyl]-2,3-dihydroazepin-6-imine |
|---|---|
| PubChem CID | 90953628 |
| Molecular Formula | C40H72N2 |
| Molecular Weight | 581.03 g/mol |
| Exact Mass | 580.57 |
| IUPAC Name | 7-cyclooctyl-4-ethyl-2-[5-ethyl-4-(4-ethylnonan-4-yl)-3,4-dimethylcyclononyl]-2,3-dihydroazepin-6-imine |
| SMILES | [H]/N=C1\C=C(CC)CC(C2CCCCC(CC)C(C)(C(CC)(CCC)CCCCC)C(C)C2)N=C1C1CCCCCCC1 |
| InChI | InChI=1S/C40H72N2/c1-8-13-21-27-40(12-5,26-9-2)39(7)31(6)28-34(24-19-20-25-35(39)11-4)37-30-32(10-3)29-36(41)38(42-37)33-22-17-15-14-16-18-23-33/h29,31,33-35,37,41H,8-28,30H2,1-7H3/b41-36+ |
| InChIKey | CVSSLFLIGMBWAY-JWBCNFBXSA-N |
| XLogP | 12.94 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.03 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|