About (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate
(2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate (PubChem CID 90953961) has the molecular formula C18H25N3O7S2
and a molecular weight of 459.55 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate.
Molecular Properties
| Compound Name | (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate |
| PubChem CID | 90953961 |
| Molecular Formula | C18H25N3O7S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate |
| SMILES | CCn1nccc1OC(=O)c1ccc(S(C)(=O)=O)c(NCCOC)c1CS(C)(=O)=O |
| InChI | InChI=1S/C18H25N3O7S2/c1-5-21-16(8-9-20-21)28-18(22)13-6-7-15(30(4,25)26)17(19-10-11-27-2)14(13)12-29(3,23)24/h6-9,19H,5,10-12H2,1-4H3 |
| InChIKey | QNNLXBVZNYCASH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate?
The IUPAC name of (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate (CID 90953961) is (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate.
What is the SMILES notation for (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate?
The canonical SMILES for (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate is CCn1nccc1OC(=O)c1ccc(S(C)(=O)=O)c(NCCOC)c1CS(C)(=O)=O.
What is the InChIKey of (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate?
The InChIKey is QNNLXBVZNYCASH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O7S2/c1-5-21-16(8-9-20-21)28-18(22)13-6-7-15(30(4,25)26)17(19-10-11-27-2)14(13)12-29(3,23)24/h6-9,19H,5,10-12H2,1-4H3.
What are the key properties of (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate?
(2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate has a molecular weight of 459.55 g/mol, XLogP of 1.13, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylpyrazol-3-yl) 3-(2-methoxyethylamino)-4-methylsulfonyl-2-(methylsulfonylmethyl)benzoate is sourced from PubChem (CID 90953961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).