About 21,22,23,24-tetrahydroporphyrin-5-ol
21,22,23,24-tetrahydroporphyrin-5-ol (PubChem CID 90954032) has the molecular formula C20H16N4O
and a molecular weight of 328.38 g/mol. Its IUPAC name is 21,22,23,24-tetrahydroporphyrin-5-ol.
Molecular Properties
| Compound Name | 21,22,23,24-tetrahydroporphyrin-5-ol |
| PubChem CID | 90954032 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 21,22,23,24-tetrahydroporphyrin-5-ol |
| SMILES | OC1=c2ccc([nH]2)=Cc2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2 |
| InChI | InChI=1S/C20H16N4O/c25-20-18-7-5-16(23-18)10-14-3-1-12(21-14)9-13-2-4-15(22-13)11-17-6-8-19(20)24-17/h1-11,21-25H |
| InChIKey | USOGOYPSAHNQCZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 21,22,23,24-tetrahydroporphyrin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,22,23,24-tetrahydroporphyrin-5-ol?
The IUPAC name of 21,22,23,24-tetrahydroporphyrin-5-ol (CID 90954032) is 21,22,23,24-tetrahydroporphyrin-5-ol.
What is the SMILES notation for 21,22,23,24-tetrahydroporphyrin-5-ol?
The canonical SMILES for 21,22,23,24-tetrahydroporphyrin-5-ol is OC1=c2ccc([nH]2)=Cc2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2.
What is the InChIKey of 21,22,23,24-tetrahydroporphyrin-5-ol?
The InChIKey is USOGOYPSAHNQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O/c25-20-18-7-5-16(23-18)10-14-3-1-12(21-14)9-13-2-4-15(22-13)11-17-6-8-19(20)24-17/h1-11,21-25H.
What are the key properties of 21,22,23,24-tetrahydroporphyrin-5-ol?
21,22,23,24-tetrahydroporphyrin-5-ol has a molecular weight of 328.38 g/mol, XLogP of 0.51, 0 rotatable bonds, 5 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 21,22,23,24-tetrahydroporphyrin-5-ol is sourced from PubChem (CID 90954032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).