About benzo[d][2]benzoxepine-5,7-dione;ethane
benzo[d][2]benzoxepine-5,7-dione;ethane (PubChem CID 90954476) has the molecular formula C22H32O3
and a molecular weight of 344.50 g/mol. Its IUPAC name is benzo[d][2]benzoxepine-5,7-dione;ethane.
Molecular Properties
| Compound Name | benzo[d][2]benzoxepine-5,7-dione;ethane |
| PubChem CID | 90954476 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | benzo[d][2]benzoxepine-5,7-dione;ethane |
| SMILES | CC.CC.CC.CC.O=c1oc(=O)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C14H8O3.4C2H6/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(16)17-13;4*1-2/h1-8H;4*1-2H3 |
| InChIKey | BOZFGYDIVOTQMV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[d][2]benzoxepine-5,7-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[d][2]benzoxepine-5,7-dione;ethane?
The IUPAC name of benzo[d][2]benzoxepine-5,7-dione;ethane (CID 90954476) is benzo[d][2]benzoxepine-5,7-dione;ethane.
What is the SMILES notation for benzo[d][2]benzoxepine-5,7-dione;ethane?
The canonical SMILES for benzo[d][2]benzoxepine-5,7-dione;ethane is CC.CC.CC.CC.O=c1oc(=O)c2ccccc2c2ccccc12.
What is the InChIKey of benzo[d][2]benzoxepine-5,7-dione;ethane?
The InChIKey is BOZFGYDIVOTQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O3.4C2H6/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(16)17-13;4*1-2/h1-8H;4*1-2H3.
What are the key properties of benzo[d][2]benzoxepine-5,7-dione;ethane?
benzo[d][2]benzoxepine-5,7-dione;ethane has a molecular weight of 344.50 g/mol, XLogP of 6.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[d][2]benzoxepine-5,7-dione;ethane is sourced from PubChem (CID 90954476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).