C12H20 — CID 90954525
(1R,3S,5S)-3-ethyl-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane (PubChem CID 90954525) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (1R,3S,5S)-3-ethyl-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane.
| Compound Name | (1R,3S,5S)-3-ethyl-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 90954525 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1R,3S,5S)-3-ethyl-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane |
| SMILES | C=C1[C@@H](CC)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C12H20/c1-5-9-6-10-7-11(8(9)2)12(10,3)4/h9-11H,2,5-7H2,1,3-4H3/t9-,10-,11-/m0/s1 |
| InChIKey | QNJYCRVRFQHCLX-DCAQKATOSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|