C24H24F2N4O6S3 — CID 90954537
N-[[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 90954537) has the molecular formula C24H24F2N4O6S3 and a molecular weight of 598.68 g/mol. Its IUPAC name is N-[[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 90954537 |
| Molecular Formula | C24H24F2N4O6S3 |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | N-[[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1csc2c1S(=O)(=O)N=C(C1C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3N(Cc3ccc(F)c(F)c3)C1=O)N2 |
| InChI | InChI=1S/C24H24F2N4O6S3/c1-38(33,34)27-8-14-10-37-23-21(14)39(35,36)29-22(28-23)18-20(31)17-12-3-4-13(7-12)19(17)30(24(18)32)9-11-2-5-15(25)16(26)6-11/h2,5-6,10,12-13,17-19,27H,3-4,7-9H2,1H3,(H,28,29)/t12-,13+,17+,18?,19-/m0/s1 |
| InChIKey | QLMBRKPPYQEGDL-MXGZKJNBSA-N |
| XLogP | 2.23 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|