C23H27FN4O6S3 — CID 90954569
N-[[3-[1-[(4-fluorophenyl)methyl]-6-(2-methylpropyl)-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 90954569) has the molecular formula C23H27FN4O6S3 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-[[3-[1-[(4-fluorophenyl)methyl]-6-(2-methylpropyl)-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[1-[(4-fluorophenyl)methyl]-6-(2-methylpropyl)-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 90954569 |
| Molecular Formula | C23H27FN4O6S3 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | N-[[3-[1-[(4-fluorophenyl)methyl]-6-(2-methylpropyl)-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CC(C)CC1CC(=O)C(C2=NS(=O)(=O)c3c(CNS(C)(=O)=O)csc3N2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN4O6S3/c1-13(2)8-17-9-18(29)19(23(30)28(17)11-14-4-6-16(24)7-5-14)21-26-22-20(37(33,34)27-21)15(12-35-22)10-25-36(3,31)32/h4-7,12-13,17,19,25H,8-11H2,1-3H3,(H,26,27) |
| InChIKey | AJQNPTWRLZUDJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|