C8H9NO — CID 90954841
2,3,3a,4-tetrahydroisoindol-1-one (PubChem CID 90954841) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydroisoindol-1-one.
| Compound Name | 2,3,3a,4-tetrahydroisoindol-1-one |
|---|---|
| PubChem CID | 90954841 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2,3,3a,4-tetrahydroisoindol-1-one |
| SMILES | O=C1NCC2CC=CC=C12 |
| InChI | InChI=1S/C8H9NO/c10-8-7-4-2-1-3-6(7)5-9-8/h1-2,4,6H,3,5H2,(H,9,10) |
| InChIKey | MHTICSKNZPKCAB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |