About 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one
5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one (PubChem CID 90955409) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one |
| PubChem CID | 90955409 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one |
| SMILES | CCCCCCC(=O)C(=CCC(C)(OC)OC)CO |
| InChI | InChI=1S/C15H28O4/c1-5-6-7-8-9-14(17)13(12-16)10-11-15(2,18-3)19-4/h10,16H,5-9,11-12H2,1-4H3 |
| InChIKey | CVXUKEHYDFUWPQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one?
The IUPAC name of 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one (CID 90955409) is 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one.
What is the SMILES notation for 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one?
The canonical SMILES for 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one is CCCCCCC(=O)C(=CCC(C)(OC)OC)CO.
What is the InChIKey of 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one?
The InChIKey is CVXUKEHYDFUWPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4/c1-5-6-7-8-9-14(17)13(12-16)10-11-15(2,18-3)19-4/h10,16H,5-9,11-12H2,1-4H3.
What are the key properties of 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one?
5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one has a molecular weight of 272.38 g/mol, XLogP of 2.84, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-2,2-dimethoxydodec-4-en-6-one is sourced from PubChem (CID 90955409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).