About 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol
1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol (PubChem CID 90955696) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol |
| PubChem CID | 90955696 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol |
| SMILES | CN(c1ncnc2ccc(-c3cccc(Cn4c(O)ccc4O)c3)cc12)C1CC1 |
| InChI | InChI=1S/C23H22N4O2/c1-26(18-6-7-18)23-19-12-17(5-8-20(19)24-14-25-23)16-4-2-3-15(11-16)13-27-21(28)9-10-22(27)29/h2-5,8-12,14,18,28-29H,6-7,13H2,1H3 |
| InChIKey | GIDDOFPGONPRRV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol?
The IUPAC name of 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol (CID 90955696) is 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol.
What is the SMILES notation for 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol?
The canonical SMILES for 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol is CN(c1ncnc2ccc(-c3cccc(Cn4c(O)ccc4O)c3)cc12)C1CC1.
What is the InChIKey of 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol?
The InChIKey is GIDDOFPGONPRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-26(18-6-7-18)23-19-12-17(5-8-20(19)24-14-25-23)16-4-2-3-15(11-16)13-27-21(28)9-10-22(27)29/h2-5,8-12,14,18,28-29H,6-7,13H2,1H3.
What are the key properties of 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol?
1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol has a molecular weight of 386.46 g/mol, XLogP of 4.16, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-[4-[cyclopropyl(methyl)amino]quinazolin-6-yl]phenyl]methyl]pyrrole-2,5-diol is sourced from PubChem (CID 90955696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).