C19H37NO2 — CID 90955762
3-(dimethylamino)propyl 2-(2,2-dimethylpropyl)-2,3,3,4-tetramethylpent-4-enoate (PubChem CID 90955762) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-(2,2-dimethylpropyl)-2,3,3,4-tetramethylpent-4-enoate.
| Compound Name | 3-(dimethylamino)propyl 2-(2,2-dimethylpropyl)-2,3,3,4-tetramethylpent-4-enoate |
|---|---|
| PubChem CID | 90955762 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | 3-(dimethylamino)propyl 2-(2,2-dimethylpropyl)-2,3,3,4-tetramethylpent-4-enoate |
| SMILES | C=C(C)C(C)(C)C(C)(CC(C)(C)C)C(=O)OCCCN(C)C |
| InChI | InChI=1S/C19H37NO2/c1-15(2)18(6,7)19(8,14-17(3,4)5)16(21)22-13-11-12-20(9)10/h1,11-14H2,2-10H3 |
| InChIKey | OQFILPXKAYMGGZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|