About 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine
5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine (PubChem CID 90955802) has the molecular formula C12H22N4S
and a molecular weight of 254.40 g/mol. Its IUPAC name is 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine |
| PubChem CID | 90955802 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine |
| SMILES | NC(CCCCN1CCNCC1)c1cncs1 |
| InChI | InChI=1S/C12H22N4S/c13-11(12-9-15-10-17-12)3-1-2-6-16-7-4-14-5-8-16/h9-11,14H,1-8,13H2 |
| InChIKey | KRADUEMLLRYCMO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine?
The IUPAC name of 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine (CID 90955802) is 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine.
What is the SMILES notation for 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine?
The canonical SMILES for 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine is NC(CCCCN1CCNCC1)c1cncs1.
What is the InChIKey of 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine?
The InChIKey is KRADUEMLLRYCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4S/c13-11(12-9-15-10-17-12)3-1-2-6-16-7-4-14-5-8-16/h9-11,14H,1-8,13H2.
What are the key properties of 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine?
5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine has a molecular weight of 254.40 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperazin-1-yl-1-(1,3-thiazol-5-yl)pentan-1-amine is sourced from PubChem (CID 90955802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).