About 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one
3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one (PubChem CID 90955944) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one |
| PubChem CID | 90955944 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccccc2CC1c1ncc[nH]1 |
| InChI | InChI=1S/C12H10N2O2/c15-12-9(11-13-5-6-14-11)7-8-3-1-2-4-10(8)16-12/h1-6,9H,7H2,(H,13,14) |
| InChIKey | IUHAMJCCVYAZGE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one?
The IUPAC name of 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one (CID 90955944) is 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one.
What is the SMILES notation for 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one?
The canonical SMILES for 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one is O=C1Oc2ccccc2CC1c1ncc[nH]1.
What is the InChIKey of 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one?
The InChIKey is IUHAMJCCVYAZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-12-9(11-13-5-6-14-11)7-8-3-1-2-4-10(8)16-12/h1-6,9H,7H2,(H,13,14).
What are the key properties of 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one?
3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one has a molecular weight of 214.22 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-2-yl)-3,4-dihydrochromen-2-one is sourced from PubChem (CID 90955944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).