About 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol
1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol (PubChem CID 90956298) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol |
| PubChem CID | 90956298 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol |
| SMILES | CC(O)c1cnc2n1CCC2 |
| InChI | InChI=1S/C8H12N2O/c1-6(11)7-5-9-8-3-2-4-10(7)8/h5-6,11H,2-4H2,1H3 |
| InChIKey | DWDOQTWDYHGUMP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol?
The IUPAC name of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol (CID 90956298) is 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol.
What is the SMILES notation for 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol?
The canonical SMILES for 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol is CC(O)c1cnc2n1CCC2.
What is the InChIKey of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol?
The InChIKey is DWDOQTWDYHGUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6(11)7-5-9-8-3-2-4-10(7)8/h5-6,11H,2-4H2,1H3.
What are the key properties of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol?
1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol has a molecular weight of 152.20 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)ethanol is sourced from PubChem (CID 90956298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).