C11H22N2O4 — CID 90956305
2-amino-3-[(2S)-2-amino-4-methylpentanoyl]oxy-3-methylbutanoic acid (PubChem CID 90956305) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-amino-3-[(2S)-2-amino-4-methylpentanoyl]oxy-3-methylbutanoic acid.
| Compound Name | 2-amino-3-[(2S)-2-amino-4-methylpentanoyl]oxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90956305 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-amino-3-[(2S)-2-amino-4-methylpentanoyl]oxy-3-methylbutanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)OC(C)(C)C(N)C(=O)O |
| InChI | InChI=1S/C11H22N2O4/c1-6(2)5-7(12)10(16)17-11(3,4)8(13)9(14)15/h6-8H,5,12-13H2,1-4H3,(H,14,15)/t7-,8?/m0/s1 |
| InChIKey | GUIVPPYXHPNVMR-JAMMHHFISA-N |
| XLogP | 0.09 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |