C18H28O3 — CID 90956463
(4aS,5R,7R,8S,8aR)-8-(1,3-dioxolan-2-yl)-7,8-dimethyl-5-prop-1-en-2-yl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one (PubChem CID 90956463) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4aS,5R,7R,8S,8aR)-8-(1,3-dioxolan-2-yl)-7,8-dimethyl-5-prop-1-en-2-yl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one.
| Compound Name | (4aS,5R,7R,8S,8aR)-8-(1,3-dioxolan-2-yl)-7,8-dimethyl-5-prop-1-en-2-yl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 90956463 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (4aS,5R,7R,8S,8aR)-8-(1,3-dioxolan-2-yl)-7,8-dimethyl-5-prop-1-en-2-yl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one |
| SMILES | C=C(C)[C@@H]1C[C@@H](C)[C@](C)(C2OCCO2)[C@@H]2CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C18H28O3/c1-11(2)15-9-12(3)18(4,17-20-7-8-21-17)16-10-13(19)5-6-14(15)16/h12,14-17H,1,5-10H2,2-4H3/t12-,14+,15+,16-,18+/m1/s1 |
| InChIKey | VKWQOJQDACRBIO-VUJCFQJHSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|