C30H31FN4O8 — CID 90956647
(4S,4aS,5aR,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)benzoyl]amino]-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90956647) has the molecular formula C30H31FN4O8 and a molecular weight of 594.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)benzoyl]amino]-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)benzoyl]amino]-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90956647 |
| Molecular Formula | C30H31FN4O8 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)benzoyl]amino]-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccccc1C(=O)Nc1cc(F)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C30H31FN4O8/c1-34(2)18-8-6-5-7-13(18)29(42)33-17-11-16(31)14-9-12-10-15-22(35(3)4)25(38)21(28(32)41)27(40)30(15,43)26(39)19(12)24(37)20(14)23(17)36/h5-8,11-12,15,19,21-22,36,43H,9-10H2,1-4H3,(H2,32,41)(H,33,42)/t12-,15-,19?,21?,22-,30-/m0/s1 |
| InChIKey | PGAUTVWGSZGTLU-MGSGUCABSA-N |
| XLogP | 0.32 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|