C24H20N2O4S — CID 90956722
2-[3-(2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)-1H-indol-2-yl]acetic acid (PubChem CID 90956722) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-[3-(2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)-1H-indol-2-yl]acetic acid.
| Compound Name | 2-[3-(2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)-1H-indol-2-yl]acetic acid |
|---|---|
| PubChem CID | 90956722 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[3-(2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)-1H-indol-2-yl]acetic acid |
| SMILES | O=C(O)Cc1[nH]c2ccccc2c1C1c2ccccc2S(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H20N2O4S/c27-22(28)14-20-23(17-10-4-6-12-19(17)25-20)24-18-11-5-7-13-21(18)31(29,30)26(24)15-16-8-2-1-3-9-16/h1-13,24-25H,14-15H2,(H,27,28) |
| InChIKey | RMAKATPYXKRVII-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|