C8H15N3O2 — CID 90956731
1,4,6-trimethyl-6-nitro-5,7-dihydro-1,4-diazepine (PubChem CID 90956731) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1,4,6-trimethyl-6-nitro-5,7-dihydro-1,4-diazepine.
| Compound Name | 1,4,6-trimethyl-6-nitro-5,7-dihydro-1,4-diazepine |
|---|---|
| PubChem CID | 90956731 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1,4,6-trimethyl-6-nitro-5,7-dihydro-1,4-diazepine |
| SMILES | CN1C=CN(C)CC(C)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C8H15N3O2/c1-8(11(12)13)6-9(2)4-5-10(3)7-8/h4-5H,6-7H2,1-3H3 |
| InChIKey | CBWQEOYDYDKRBE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|