C7H13O4P — CID 90957671
(2R,3R,4S,5R)-2-methyl-6-(phosphanylmethylidene)oxane-3,4,5-triol (PubChem CID 90957671) has the molecular formula C7H13O4P and a molecular weight of 192.15 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-methyl-6-(phosphanylmethylidene)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-methyl-6-(phosphanylmethylidene)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90957671 |
| Molecular Formula | C7H13O4P |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (2R,3R,4S,5R)-2-methyl-6-(phosphanylmethylidene)oxane-3,4,5-triol |
| SMILES | C[C@H]1OC(=CP)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13O4P/c1-3-5(8)7(10)6(9)4(2-12)11-3/h2-3,5-10H,12H2,1H3/t3-,5+,6+,7+/m1/s1 |
| InChIKey | AZBMOLXNQDSCFD-DAXDWZTDSA-N |
| XLogP | -0.80 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|