C18H30BNO4S — CID 90957822
2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfonamide (PubChem CID 90957822) has the molecular formula C18H30BNO4S and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfonamide.
| Compound Name | 2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfonamide |
|---|---|
| PubChem CID | 90957822 |
| Molecular Formula | C18H30BNO4S |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfonamide |
| SMILES | CC1(C)OB(c2ccc(CCCC(C)(C)S(N)(=O)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H30BNO4S/c1-16(2,25(20,21)22)13-7-8-14-9-11-15(12-10-14)19-23-17(3,4)18(5,6)24-19/h9-12H,7-8,13H2,1-6H3,(H2,20,21,22) |
| InChIKey | PPYLZLJGXFMSDK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|