C25H32O10 — CID 90958326
2-[(1S,3R,7S,12R,14S,17R,19S,20R,21R,27S,29R)-20-hydroxy-2,8,10,13,18,22,28-heptaoxahexacyclo[15.13.0.03,14.07,12.019,29.021,27]triaconta-5,15,24-trien-9-yl]acetic acid (PubChem CID 90958326) has the molecular formula C25H32O10 and a molecular weight of 492.52 g/mol. Its IUPAC name is 2-[(1S,3R,7S,12R,14S,17R,19S,20R,21R,27S,29R)-20-hydroxy-2,8,10,13,18,22,28-heptaoxahexacyclo[15.13.0.03,14.07,12.019,29.021,27]triaconta-5,15,24-trien-9-yl]acetic acid.
| Compound Name | 2-[(1S,3R,7S,12R,14S,17R,19S,20R,21R,27S,29R)-20-hydroxy-2,8,10,13,18,22,28-heptaoxahexacyclo[15.13.0.03,14.07,12.019,29.021,27]triaconta-5,15,24-trien-9-yl]acetic acid |
|---|---|
| PubChem CID | 90958326 |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-[(1S,3R,7S,12R,14S,17R,19S,20R,21R,27S,29R)-20-hydroxy-2,8,10,13,18,22,28-heptaoxahexacyclo[15.13.0.03,14.07,12.019,29.021,27]triaconta-5,15,24-trien-9-yl]acetic acid |
| SMILES | O=C(O)CC1OC[C@H]2O[C@H]3C=C[C@H]4O[C@H]5[C@H](O)[C@H]6OCC=CC[C@@H]6O[C@@H]5C[C@@H]4O[C@@H]3CC=C[C@@H]2O1 |
| InChI | InChI=1S/C25H32O10/c26-21(27)11-22-30-12-20-14(34-22)6-3-5-13-15(32-20)7-8-16-18(31-13)10-19-25(35-16)23(28)24-17(33-19)4-1-2-9-29-24/h1-3,6-8,13-20,22-25,28H,4-5,9-12H2,(H,26,27)/t13-,14+,15+,16-,17+,18+,19-,20-,22?,23-,24+,25-/m1/s1 |
| InChIKey | XIJLRYHHAQASDW-HUEALPEDSA-N |
| XLogP | 0.87 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|