C22H42O12Si8 — CID 90958460
1-(4-ethenylphenyl)-3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane (PubChem CID 90958460) has the molecular formula C22H42O12Si8 and a molecular weight of 723.25 g/mol. Its IUPAC name is 1-(4-ethenylphenyl)-3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane.
| Compound Name | 1-(4-ethenylphenyl)-3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane |
|---|---|
| PubChem CID | 90958460 |
| Molecular Formula | C22H42O12Si8 |
| Molecular Weight | 723.25 g/mol |
| Exact Mass | 722.08 |
| IUPAC Name | 1-(4-ethenylphenyl)-3,5,7,9,11,13,15-heptaethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane |
| SMILES | C=Cc1ccc([Si]23O[Si]4(CC)O[Si]5(CC)O[Si]6(CC)O[Si](CC)(O4)O[Si](CC)(O[Si](CC)(O6)O[Si](CC)(O5)O2)O3)cc1 |
| InChI | InChI=1S/C22H42O12Si8/c1-9-21-17-19-22(20-18-21)42-32-39(14-6)26-36(11-3)23-35(10-2)24-37(12-4,28-39)30-41(16-8,34-42)31-38(13-5,25-35)29-40(15-7,27-36)33-42/h9,17-20H,1,10-16H2,2-8H3 |
| InChIKey | YXQKILOJQGOLSG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|