C12H21N3O8S2 — CID 90958503
2-[methyl(methylsulfonyl)amino]-N-(1,2,3,4-tetrahydroxy-5-methoxypentan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 90958503) has the molecular formula C12H21N3O8S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[methyl(methylsulfonyl)amino]-N-(1,2,3,4-tetrahydroxy-5-methoxypentan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[methyl(methylsulfonyl)amino]-N-(1,2,3,4-tetrahydroxy-5-methoxypentan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90958503 |
| Molecular Formula | C12H21N3O8S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-[methyl(methylsulfonyl)amino]-N-(1,2,3,4-tetrahydroxy-5-methoxypentan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | COCC(O)C(O)C(O)(CO)NC(=O)c1csc(N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H21N3O8S2/c1-15(25(3,21)22)11-13-7(5-24-11)10(19)14-12(20,6-16)9(18)8(17)4-23-2/h5,8-9,16-18,20H,4,6H2,1-3H3,(H,14,19) |
| InChIKey | XXIFGLBSLFXRED-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 169.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|