C25H26N4O6 — CID 90958523
5-[[3-[[3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]-2-methylcyclohexen-1-yl]methylidene]-2-methylcyclohexen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 90958523) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is 5-[[3-[[3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]-2-methylcyclohexen-1-yl]methylidene]-2-methylcyclohexen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-[[3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]-2-methylcyclohexen-1-yl]methylidene]-2-methylcyclohexen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90958523 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 5-[[3-[[3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]-2-methylcyclohexen-1-yl]methylidene]-2-methylcyclohexen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=C(C=C2CCCC(C=C3C(=O)NC(=O)NC3=O)=C2C)CCCC1=Cc1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H26N4O6/c1-12-14(5-3-7-16(12)10-18-20(30)26-24(34)27-21(18)31)9-15-6-4-8-17(13(15)2)11-19-22(32)28-25(35)29-23(19)33/h9-11H,3-8H2,1-2H3,(H2,26,27,30,31,34)(H3,28,29,32,33,35) |
| InChIKey | DKVURNLMSSKTME-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|