About 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine
5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine (PubChem CID 90958585) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine.
Molecular Properties
| Compound Name | 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine |
| PubChem CID | 90958585 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine |
| SMILES | NC1(N)CCc2ncsc2C1 |
| InChI | InChI=1S/C7H11N3S/c8-7(9)2-1-5-6(3-7)11-4-10-5/h4H,1-3,8-9H2 |
| InChIKey | HVAZTMDZSZBEEZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine?
The IUPAC name of 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine (CID 90958585) is 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine.
What is the SMILES notation for 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine?
The canonical SMILES for 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine is NC1(N)CCc2ncsc2C1.
What is the InChIKey of 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine?
The InChIKey is HVAZTMDZSZBEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c8-7(9)2-1-5-6(3-7)11-4-10-5/h4H,1-3,8-9H2.
What are the key properties of 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine?
5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine has a molecular weight of 169.25 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-4H-1,3-benzothiazole-6,6-diamine is sourced from PubChem (CID 90958585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).