C11H12Br2N2O6 — CID 90958596
5-(1,2-dibromoethenyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90958596) has the molecular formula C11H12Br2N2O6 and a molecular weight of 428.03 g/mol. Its IUPAC name is 5-(1,2-dibromoethenyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(1,2-dibromoethenyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90958596 |
| Molecular Formula | C11H12Br2N2O6 |
| Molecular Weight | 428.03 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | 5-(1,2-dibromoethenyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1C(Br)=CBr |
| InChI | InChI=1S/C11H12Br2N2O6/c12-1-5(13)4-2-15(11(20)14-9(4)19)10-8(18)7(17)6(3-16)21-10/h1-2,6-8,10,16-18H,3H2,(H,14,19,20)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | IAGYHBQPNFGKRP-FDDDBJFASA-N |
| XLogP | -0.76 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.03 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |