About 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole
2-chloro-4-methyl-2,3-dihydro-1,3-thiazole (PubChem CID 90958650) has the molecular formula C4H6ClNS
and a molecular weight of 135.62 g/mol. Its IUPAC name is 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole |
| PubChem CID | 90958650 |
| Molecular Formula | C4H6ClNS |
| Molecular Weight | 135.62 g/mol |
| Exact Mass | 134.99 |
| IUPAC Name | 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole |
| SMILES | CC1=CSC(Cl)N1 |
| InChI | InChI=1S/C4H6ClNS/c1-3-2-7-4(5)6-3/h2,4,6H,1H3 |
| InChIKey | ILJIKEBMSXBWTK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.62 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole?
The IUPAC name of 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole (CID 90958650) is 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole is CC1=CSC(Cl)N1.
What is the InChIKey of 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole?
The InChIKey is ILJIKEBMSXBWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClNS/c1-3-2-7-4(5)6-3/h2,4,6H,1H3.
What are the key properties of 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole?
2-chloro-4-methyl-2,3-dihydro-1,3-thiazole has a molecular weight of 135.62 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 90958650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).