C28H38O6 — CID 90958756
(1R,7S,8S,10S,18R)-12-[(1S)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 90958756) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is (1R,7S,8S,10S,18R)-12-[(1S)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (1R,7S,8S,10S,18R)-12-[(1S)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 90958756 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (1R,7S,8S,10S,18R)-12-[(1S)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CCC[C@@H]2CC=C[C@@H](CC=CC(=O)OC([C@@H](O)C=CC3CC=CC3)C[C@@H]3O[C@H]3[C@@H](O)C1)O2 |
| InChI | InChI=1S/C28H38O6/c1-19-7-4-10-21-11-5-12-22(32-21)13-6-14-27(31)33-25(18-26-28(34-26)24(30)17-19)23(29)16-15-20-8-2-3-9-20/h2-3,5-6,12,14-16,20-26,28-30H,1,4,7-11,13,17-18H2/t21-,22+,23+,24+,25?,26+,28+/m1/s1 |
| InChIKey | VNTUUKGMKRFCTD-MOXSUTHTSA-N |
| XLogP | 4.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|