C17H31NO4 — CID 90958820
3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-6-(2-methylprop-1-enyl)-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole (PubChem CID 90958820) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-6-(2-methylprop-1-enyl)-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole.
| Compound Name | 3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-6-(2-methylprop-1-enyl)-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 90958820 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-6-(2-methylprop-1-enyl)-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole |
| SMILES | COC1(OC)COC2C(C=C(C)C)CN(COC(C)(C)C)C21 |
| InChI | InChI=1S/C17H31NO4/c1-12(2)8-13-9-18(11-22-16(3,4)5)15-14(13)21-10-17(15,19-6)20-7/h8,13-15H,9-11H2,1-7H3 |
| InChIKey | XQUGNKJAVSXRNP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|