C11H13N3OS — CID 90958967
[(2R)-1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-2-yl]methanol (PubChem CID 90958967) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is [(2R)-1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 90958967 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [(2R)-1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1c1ncc2sccc2n1 |
| InChI | InChI=1S/C11H13N3OS/c15-7-8-2-1-4-14(8)11-12-6-10-9(13-11)3-5-16-10/h3,5-6,8,15H,1-2,4,7H2/t8-/m1/s1 |
| InChIKey | WHGOVFRYCHUCRH-MRVPVSSYSA-N |
| XLogP | 1.65 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |