About tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate
tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate (PubChem CID 90959113) has the molecular formula C16H23Cl2NO6S
and a molecular weight of 428.33 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate |
| PubChem CID | 90959113 |
| Molecular Formula | C16H23Cl2NO6S |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate |
| SMILES | COc1cc(Cl)cc(Cl)c1S(=O)(=O)CNCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23Cl2NO6S/c1-16(2,3)25-14(20)9-24-6-5-19-10-26(21,22)15-12(18)7-11(17)8-13(15)23-4/h7-8,19H,5-6,9-10H2,1-4H3 |
| InChIKey | ZLGKVZRQTXRGMM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate?
The IUPAC name of tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate (CID 90959113) is tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate.
What is the SMILES notation for tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate?
The canonical SMILES for tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate is COc1cc(Cl)cc(Cl)c1S(=O)(=O)CNCCOCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate?
The InChIKey is ZLGKVZRQTXRGMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2NO6S/c1-16(2,3)25-14(20)9-24-6-5-19-10-26(21,22)15-12(18)7-11(17)8-13(15)23-4/h7-8,19H,5-6,9-10H2,1-4H3.
What are the key properties of tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate?
tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate has a molecular weight of 428.33 g/mol, XLogP of 2.68, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-[(2,4-dichloro-6-methoxyphenyl)sulfonylmethylamino]ethoxy]acetate is sourced from PubChem (CID 90959113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).