C10H13N3O — CID 90959919
N-[1-methoxy-2-(4-methylimidazol-1-yl)buta-1,3-dienyl]methanimine (PubChem CID 90959919) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N-[1-methoxy-2-(4-methylimidazol-1-yl)buta-1,3-dienyl]methanimine.
| Compound Name | N-[1-methoxy-2-(4-methylimidazol-1-yl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 90959919 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-[1-methoxy-2-(4-methylimidazol-1-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=CC(=C(N=C)OC)n1cnc(C)c1 |
| InChI | InChI=1S/C10H13N3O/c1-5-9(10(11-3)14-4)13-6-8(2)12-7-13/h5-7H,1,3H2,2,4H3 |
| InChIKey | MPTLMMXQCVJNFK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|