C21H20ClF3N4S — CID 90959975
1-(4-chlorocyclohexylidene)-N'-[5-isoquinolin-6-yl-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine (PubChem CID 90959975) has the molecular formula C21H20ClF3N4S and a molecular weight of 452.93 g/mol. Its IUPAC name is 1-(4-chlorocyclohexylidene)-N'-[5-isoquinolin-6-yl-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine.
| Compound Name | 1-(4-chlorocyclohexylidene)-N'-[5-isoquinolin-6-yl-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 90959975 |
| Molecular Formula | C21H20ClF3N4S |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-(4-chlorocyclohexylidene)-N'-[5-isoquinolin-6-yl-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine |
| SMILES | NC(CNc1nc(C(F)(F)F)c(-c2ccc3cnccc3c2)s1)=C1CCC(Cl)CC1 |
| InChI | InChI=1S/C21H20ClF3N4S/c22-16-5-3-12(4-6-16)17(26)11-28-20-29-19(21(23,24)25)18(30-20)14-1-2-15-10-27-8-7-13(15)9-14/h1-2,7-10,16H,3-6,11,26H2,(H,28,29)/b17-12- |
| InChIKey | KCMNAGROCCEFRC-ATVHPVEESA-N |
| XLogP | 6.18 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|