C20H16Cl2N4O — CID 90960380
1-[3,5-dichloro-4-(pyrido[4,3-c][1,6]naphthyridin-6-ylamino)phenyl]propan-1-ol (PubChem CID 90960380) has the molecular formula C20H16Cl2N4O and a molecular weight of 399.28 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(pyrido[4,3-c][1,6]naphthyridin-6-ylamino)phenyl]propan-1-ol.
| Compound Name | 1-[3,5-dichloro-4-(pyrido[4,3-c][1,6]naphthyridin-6-ylamino)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 90960380 |
| Molecular Formula | C20H16Cl2N4O |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-[3,5-dichloro-4-(pyrido[4,3-c][1,6]naphthyridin-6-ylamino)phenyl]propan-1-ol |
| SMILES | CCC(O)c1cc(Cl)c(Nc2nc3ccncc3c3cnccc23)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O/c1-2-18(27)11-7-15(21)19(16(22)8-11)26-20-12-3-5-23-9-13(12)14-10-24-6-4-17(14)25-20/h3-10,18,27H,2H2,1H3,(H,25,26) |
| InChIKey | PRMHKRTYGRHZDS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|