C26H48O8 — CID 90960429
1-[(2S,3R,4S,5R)-5-acetyl-3,4,5-trihydroxy-3,4-bis(2-methylpropyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one (PubChem CID 90960429) has the molecular formula C26H48O8 and a molecular weight of 488.66 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-5-acetyl-3,4,5-trihydroxy-3,4-bis(2-methylpropyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one.
| Compound Name | 1-[(2S,3R,4S,5R)-5-acetyl-3,4,5-trihydroxy-3,4-bis(2-methylpropyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 90960429 |
| Molecular Formula | C26H48O8 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-5-acetyl-3,4,5-trihydroxy-3,4-bis(2-methylpropyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one |
| SMILES | CCCCCCCCOC1O[C@H](C(=O)C(C)O)[C@](O)(CC(C)C)[C@@](O)(CC(C)C)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C26H48O8/c1-8-9-10-11-12-13-14-33-23-26(32,20(7)28)25(31,16-18(4)5)24(30,15-17(2)3)22(34-23)21(29)19(6)27/h17-19,22-23,27,30-32H,8-16H2,1-7H3/t19?,22-,23?,24-,25+,26+/m1/s1 |
| InChIKey | OZFHBSDWTQKTHD-BMOJHTOXSA-N |
| XLogP | 2.91 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|