C21H28N2O5S — CID 90960564
4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 90960564) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90960564 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CC(NC1CCC(c2ccc(S(=O)(=O)NCCO)cc2)C1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H28N2O5S/c1-14(16-5-9-20(25)21(26)13-16)23-18-6-2-17(12-18)15-3-7-19(8-4-15)29(27,28)22-10-11-24/h3-5,7-9,13-14,17-18,22-26H,2,6,10-12H2,1H3 |
| InChIKey | DHYJERFXJDQNRJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|