About 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide
4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 90960564) has the molecular formula C21H28N2O5S
and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide |
| PubChem CID | 90960564 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CC(NC1CCC(c2ccc(S(=O)(=O)NCCO)cc2)C1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H28N2O5S/c1-14(16-5-9-20(25)21(26)13-16)23-18-6-2-17(12-18)15-3-7-19(8-4-15)29(27,28)22-10-11-24/h3-5,7-9,13-14,17-18,22-26H,2,6,10-12H2,1H3 |
| InChIKey | DHYJERFXJDQNRJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide?
The IUPAC name of 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide (CID 90960564) is 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide.
What is the SMILES notation for 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide?
The canonical SMILES for 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide is CC(NC1CCC(c2ccc(S(=O)(=O)NCCO)cc2)C1)c1ccc(O)c(O)c1.
What is the InChIKey of 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide?
The InChIKey is DHYJERFXJDQNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O5S/c1-14(16-5-9-20(25)21(26)13-16)23-18-6-2-17(12-18)15-3-7-19(8-4-15)29(27,28)22-10-11-24/h3-5,7-9,13-14,17-18,22-26H,2,6,10-12H2,1H3.
What are the key properties of 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide?
4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide has a molecular weight of 420.53 g/mol, XLogP of 2.36, 8 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[1-(3,4-dihydroxyphenyl)ethylamino]cyclopentyl]-N-(2-hydroxyethyl)benzenesulfonamide is sourced from PubChem (CID 90960564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).