C12H30N2O — CID 90960684
1,4-dimethylpiperazine;methoxyethane;propane (PubChem CID 90960684) has the molecular formula C12H30N2O and a molecular weight of 218.38 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;methoxyethane;propane.
| Compound Name | 1,4-dimethylpiperazine;methoxyethane;propane |
|---|---|
| PubChem CID | 90960684 |
| Molecular Formula | C12H30N2O |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.24 |
| IUPAC Name | 1,4-dimethylpiperazine;methoxyethane;propane |
| SMILES | CCC.CCOC.CN1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2.C3H8O.C3H8/c1-7-3-5-8(2)6-4-7;1-3-4-2;1-3-2/h3-6H2,1-2H3;3H2,1-2H3;3H2,1-2H3 |
| InChIKey | OWSNJRIRFSGZFX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |