C33H61N5 — CID 90960731
14,20-diethyl-2,7,15,19-tetramethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane (PubChem CID 90960731) has the molecular formula C33H61N5 and a molecular weight of 527.89 g/mol. Its IUPAC name is 14,20-diethyl-2,7,15,19-tetramethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane.
| Compound Name | 14,20-diethyl-2,7,15,19-tetramethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane |
|---|---|
| PubChem CID | 90960731 |
| Molecular Formula | C33H61N5 |
| Molecular Weight | 527.89 g/mol |
| Exact Mass | 527.49 |
| IUPAC Name | 14,20-diethyl-2,7,15,19-tetramethyl-26,27,28,29,30-pentazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triacontane |
| SMILES | CCC1C2CC3CCC(N3)C(C)C3CCC(N3)C(C)C3CCC(CC4NC(CC(N2)C1C)C(C)C4CC)N3 |
| InChI | InChI=1S/C33H61N5/c1-7-24-18(3)30-17-31-19(4)25(8-2)33(38-31)16-23-10-12-27(35-23)21(6)29-14-13-28(36-29)20(5)26-11-9-22(34-26)15-32(24)37-30/h18-38H,7-17H2,1-6H3 |
| InChIKey | DZBJOOURFJFLMS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |