About 10-methyl-8,9-dihydrocycloocta[b]pyridine
10-methyl-8,9-dihydrocycloocta[b]pyridine (PubChem CID 90961108) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 10-methyl-8,9-dihydrocycloocta[b]pyridine.
Molecular Properties
| Compound Name | 10-methyl-8,9-dihydrocycloocta[b]pyridine |
| PubChem CID | 90961108 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 10-methyl-8,9-dihydrocycloocta[b]pyridine |
| SMILES | CC1=c2ncccc2=CC=CCC1 |
| InChI | InChI=1S/C12H13N/c1-10-6-3-2-4-7-11-8-5-9-13-12(10)11/h2,4-5,7-9H,3,6H2,1H3 |
| InChIKey | SGLGEBUIJYVKLS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-methyl-8,9-dihydrocycloocta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-8,9-dihydrocycloocta[b]pyridine?
The IUPAC name of 10-methyl-8,9-dihydrocycloocta[b]pyridine (CID 90961108) is 10-methyl-8,9-dihydrocycloocta[b]pyridine.
What is the SMILES notation for 10-methyl-8,9-dihydrocycloocta[b]pyridine?
The canonical SMILES for 10-methyl-8,9-dihydrocycloocta[b]pyridine is CC1=c2ncccc2=CC=CCC1.
What is the InChIKey of 10-methyl-8,9-dihydrocycloocta[b]pyridine?
The InChIKey is SGLGEBUIJYVKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-10-6-3-2-4-7-11-8-5-9-13-12(10)11/h2,4-5,7-9H,3,6H2,1H3.
What are the key properties of 10-methyl-8,9-dihydrocycloocta[b]pyridine?
10-methyl-8,9-dihydrocycloocta[b]pyridine has a molecular weight of 171.24 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-8,9-dihydrocycloocta[b]pyridine is sourced from PubChem (CID 90961108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).