C28H37BN2O5 — CID 90961257
tert-butyl N-[(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamate (PubChem CID 90961257) has the molecular formula C28H37BN2O5 and a molecular weight of 492.43 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 90961257 |
| Molecular Formula | C28H37BN2O5 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)N1CCc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C28H37BN2O5/c1-26(2,3)34-25(33)30-22(17-19-11-9-8-10-12-19)24(32)31-16-15-20-18-21(13-14-23(20)31)29-35-27(4,5)28(6,7)36-29/h8-14,18,22H,15-17H2,1-7H3,(H,30,33)/t22-/m1/s1 |
| InChIKey | RREFHPHQPOYFRZ-JOCHJYFZSA-N |
| XLogP | 4.01 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|